benijabhandari01 benijabhandari01

04-02-2024
Chemistry

contestada

What is the name of the element which has 20 proton ? Draw its atomic structure.

Respuesta :

SitashmaPandey SitashmaPandey

04-02-2024

Answer:

Calcium

Explanation:

Name of element: Calcium

symbol:Ca

atomic number:20

number of protons:20

number of neutrons:20

number of electrons:20

Ver imagen SitashmaPandey

Answer Link

Otras preguntas

cosec(6b+pi/8)=sec(2b-pi/8)

Help on this question angels ?

What is the story Mrs piggle wiggle about

how could practicing certain activities affect the firing and overall responsiveness of neurons?

4. Which element is highly reactive: Sodium, Helium, or Chlorine? 5. Why is Helium considered an unreactive element? 6. What determines an element's' chemical p

A student says that she is confused by the difference between ab, which means “a divides b," and alb, which is read “a divided by b." How would you help her res

What is the logic 32+2 +24=63+ 5=

1. PART A: Which statement identifies the central idea of the text?A. Juvenile offenders who are sent to adult prisons have a harder time reenteringsociety than

write a difference between append () and extend ()method of list

what type of plan will be used if there was a contamination offers that caused employees to seek medical attention for Respiratory illness